C27H32F6N2O6 — CID 22232404
2-ethoxy-3-[4-[2-[6,6,6-trifluorohexyl-[[4-(trifluoromethoxy)phenyl]carbamoyl]amino]ethoxy]phenyl]propanoic acid (PubChem CID 22232404) has the molecular formula C27H32F6N2O6 and a molecular weight of 594.55 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[6,6,6-trifluorohexyl-[[4-(trifluoromethoxy)phenyl]carbamoyl]amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[6,6,6-trifluorohexyl-[[4-(trifluoromethoxy)phenyl]carbamoyl]amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22232404 |
| Molecular Formula | C27H32F6N2O6 |
| Molecular Weight | 594.55 g/mol |
| Exact Mass | 594.22 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[6,6,6-trifluorohexyl-[[4-(trifluoromethoxy)phenyl]carbamoyl]amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCCCC(F)(F)F)C(=O)Nc2ccc(OC(F)(F)F)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C27H32F6N2O6/c1-2-39-23(24(36)37)18-19-6-10-21(11-7-19)40-17-16-35(15-5-3-4-14-26(28,29)30)25(38)34-20-8-12-22(13-9-20)41-27(31,32)33/h6-13,23H,2-5,14-18H2,1H3,(H,34,38)(H,36,37) |
| InChIKey | YJHZIPIRBFAZHL-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.55 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|