C27H35F3N2O6 — CID 22230313
2-ethoxy-3-[4-[2-[(3-methoxyphenyl)carbamoyl-(6,6,6-trifluorohexyl)amino]ethoxy]phenyl]propanoic acid (PubChem CID 22230313) has the molecular formula C27H35F3N2O6 and a molecular weight of 540.58 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[(3-methoxyphenyl)carbamoyl-(6,6,6-trifluorohexyl)amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[(3-methoxyphenyl)carbamoyl-(6,6,6-trifluorohexyl)amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22230313 |
| Molecular Formula | C27H35F3N2O6 |
| Molecular Weight | 540.58 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[(3-methoxyphenyl)carbamoyl-(6,6,6-trifluorohexyl)amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCCCC(F)(F)F)C(=O)Nc2cccc(OC)c2)cc1)C(=O)O |
| InChI | InChI=1S/C27H35F3N2O6/c1-3-37-24(25(33)34)18-20-10-12-22(13-11-20)38-17-16-32(15-6-4-5-14-27(28,29)30)26(35)31-21-8-7-9-23(19-21)36-2/h7-13,19,24H,3-6,14-18H2,1-2H3,(H,31,35)(H,33,34) |
| InChIKey | BBCGMKSEQZNDIU-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.58 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|