C26H31ClF3NO6 — CID 22231256
3-[4-[2-[(2-chlorophenoxy)carbonyl-(6,6,6-trifluorohexyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22231256) has the molecular formula C26H31ClF3NO6 and a molecular weight of 545.98 g/mol. Its IUPAC name is 3-[4-[2-[(2-chlorophenoxy)carbonyl-(6,6,6-trifluorohexyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[(2-chlorophenoxy)carbonyl-(6,6,6-trifluorohexyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22231256 |
| Molecular Formula | C26H31ClF3NO6 |
| Molecular Weight | 545.98 g/mol |
| Exact Mass | 545.18 |
| IUPAC Name | 3-[4-[2-[(2-chlorophenoxy)carbonyl-(6,6,6-trifluorohexyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCCCC(F)(F)F)C(=O)Oc2ccccc2Cl)cc1)C(=O)O |
| InChI | InChI=1S/C26H31ClF3NO6/c1-2-35-23(24(32)33)18-19-10-12-20(13-11-19)36-17-16-31(15-7-3-6-14-26(28,29)30)25(34)37-22-9-5-4-8-21(22)27/h4-5,8-13,23H,2-3,6-7,14-18H2,1H3,(H,32,33) |
| InChIKey | FITIVLUKDYKWEU-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.98 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|