C27H34F3NO7 — CID 22233756
2-ethoxy-3-[4-[2-[hexyl-[2-(trifluoromethoxy)phenoxy]carbonylamino]ethoxy]phenyl]propanoic acid (PubChem CID 22233756) has the molecular formula C27H34F3NO7 and a molecular weight of 541.56 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[hexyl-[2-(trifluoromethoxy)phenoxy]carbonylamino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[hexyl-[2-(trifluoromethoxy)phenoxy]carbonylamino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22233756 |
| Molecular Formula | C27H34F3NO7 |
| Molecular Weight | 541.56 g/mol |
| Exact Mass | 541.23 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[hexyl-[2-(trifluoromethoxy)phenoxy]carbonylamino]ethoxy]phenyl]propanoic acid |
| SMILES | CCCCCCN(CCOc1ccc(CC(OCC)C(=O)O)cc1)C(=O)Oc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C27H34F3NO7/c1-3-5-6-9-16-31(26(34)37-22-10-7-8-11-23(22)38-27(28,29)30)17-18-36-21-14-12-20(13-15-21)19-24(25(32)33)35-4-2/h7-8,10-15,24H,3-6,9,16-19H2,1-2H3,(H,32,33) |
| InChIKey | BCBLXOOFXVOIHF-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.56 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|