C27H23F14NO7 — CID 22233340
2-ethoxy-3-[4-[2-[[2-(trifluoromethoxy)phenoxy]carbonyl-(2,2,3,3,4,4,5,5,6,6,6-undecafluorohexyl)amino]ethoxy]phenyl]propanoic acid (PubChem CID 22233340) has the molecular formula C27H23F14NO7 and a molecular weight of 739.45 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[[2-(trifluoromethoxy)phenoxy]carbonyl-(2,2,3,3,4,4,5,5,6,6,6-undecafluorohexyl)amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[[2-(trifluoromethoxy)phenoxy]carbonyl-(2,2,3,3,4,4,5,5,6,6,6-undecafluorohexyl)amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22233340 |
| Molecular Formula | C27H23F14NO7 |
| Molecular Weight | 739.45 g/mol |
| Exact Mass | 739.13 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[[2-(trifluoromethoxy)phenoxy]carbonyl-(2,2,3,3,4,4,5,5,6,6,6-undecafluorohexyl)amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)Oc2ccccc2OC(F)(F)F)cc1)C(=O)O |
| InChI | InChI=1S/C27H23F14NO7/c1-2-46-19(20(43)44)13-15-7-9-16(10-8-15)47-12-11-42(21(45)48-17-5-3-4-6-18(17)49-27(39,40)41)14-22(28,29)23(30,31)24(32,33)25(34,35)26(36,37)38/h3-10,19H,2,11-14H2,1H3,(H,43,44) |
| InChIKey | JMJLMLRBMDDOKZ-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.45 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|