C28H29F11N2O5 — CID 22230792
2-ethoxy-3-[4-[2-[2-phenylethylcarbamoyl(2,2,3,3,4,4,5,5,6,6,6-undecafluorohexyl)amino]ethoxy]phenyl]propanoic acid (PubChem CID 22230792) has the molecular formula C28H29F11N2O5 and a molecular weight of 682.53 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[2-phenylethylcarbamoyl(2,2,3,3,4,4,5,5,6,6,6-undecafluorohexyl)amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[2-phenylethylcarbamoyl(2,2,3,3,4,4,5,5,6,6,6-undecafluorohexyl)amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22230792 |
| Molecular Formula | C28H29F11N2O5 |
| Molecular Weight | 682.53 g/mol |
| Exact Mass | 682.19 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[2-phenylethylcarbamoyl(2,2,3,3,4,4,5,5,6,6,6-undecafluorohexyl)amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)NCCc2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C28H29F11N2O5/c1-2-45-21(22(42)43)16-19-8-10-20(11-9-19)46-15-14-41(23(44)40-13-12-18-6-4-3-5-7-18)17-24(29,30)25(31,32)26(33,34)27(35,36)28(37,38)39/h3-11,21H,2,12-17H2,1H3,(H,40,44)(H,42,43) |
| InChIKey | MYXQGMNISMQTKH-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.53 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|