C32H46N2O5 — CID 22230267
3-[4-[2-[4-cyclohexylbutyl(2-phenylethylcarbamoyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22230267) has the molecular formula C32H46N2O5 and a molecular weight of 538.73 g/mol. Its IUPAC name is 3-[4-[2-[4-cyclohexylbutyl(2-phenylethylcarbamoyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[4-cyclohexylbutyl(2-phenylethylcarbamoyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22230267 |
| Molecular Formula | C32H46N2O5 |
| Molecular Weight | 538.73 g/mol |
| Exact Mass | 538.34 |
| IUPAC Name | 3-[4-[2-[4-cyclohexylbutyl(2-phenylethylcarbamoyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCCC2CCCCC2)C(=O)NCCc2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C32H46N2O5/c1-2-38-30(31(35)36)25-28-16-18-29(19-17-28)39-24-23-34(22-10-9-15-26-11-5-3-6-12-26)32(37)33-21-20-27-13-7-4-8-14-27/h4,7-8,13-14,16-19,26,30H,2-3,5-6,9-12,15,20-25H2,1H3,(H,33,37)(H,35,36) |
| InChIKey | VBZPQTBBULWIEK-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.73 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|