C30H40F2N2O5 — CID 22232732
3-[4-[2-[4-cyclohexylbutyl-[(2,4-difluorophenyl)carbamoyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22232732) has the molecular formula C30H40F2N2O5 and a molecular weight of 546.66 g/mol. Its IUPAC name is 3-[4-[2-[4-cyclohexylbutyl-[(2,4-difluorophenyl)carbamoyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[4-cyclohexylbutyl-[(2,4-difluorophenyl)carbamoyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22232732 |
| Molecular Formula | C30H40F2N2O5 |
| Molecular Weight | 546.66 g/mol |
| Exact Mass | 546.29 |
| IUPAC Name | 3-[4-[2-[4-cyclohexylbutyl-[(2,4-difluorophenyl)carbamoyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCCC2CCCCC2)C(=O)Nc2ccc(F)cc2F)cc1)C(=O)O |
| InChI | InChI=1S/C30H40F2N2O5/c1-2-38-28(29(35)36)20-23-11-14-25(15-12-23)39-19-18-34(17-7-6-10-22-8-4-3-5-9-22)30(37)33-27-16-13-24(31)21-26(27)32/h11-16,21-22,28H,2-10,17-20H2,1H3,(H,33,37)(H,35,36) |
| InChIKey | VWFSSWLDNYWGTQ-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.66 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|