C27H44N2O5 — CID 22230491
3-[4-[2-[4-cyclohexylbutyl(propan-2-ylcarbamoyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22230491) has the molecular formula C27H44N2O5 and a molecular weight of 476.66 g/mol. Its IUPAC name is 3-[4-[2-[4-cyclohexylbutyl(propan-2-ylcarbamoyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[4-cyclohexylbutyl(propan-2-ylcarbamoyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22230491 |
| Molecular Formula | C27H44N2O5 |
| Molecular Weight | 476.66 g/mol |
| Exact Mass | 476.33 |
| IUPAC Name | 3-[4-[2-[4-cyclohexylbutyl(propan-2-ylcarbamoyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCCC2CCCCC2)C(=O)NC(C)C)cc1)C(=O)O |
| InChI | InChI=1S/C27H44N2O5/c1-4-33-25(26(30)31)20-23-13-15-24(16-14-23)34-19-18-29(27(32)28-21(2)3)17-9-8-12-22-10-6-5-7-11-22/h13-16,21-22,25H,4-12,17-20H2,1-3H3,(H,28,32)(H,30,31) |
| InChIKey | XMKQGBDDTLKMGI-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.66 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|