C23H36F2N2O5 — CID 22231233
3-[4-[2-[5,5-difluorohexyl(propan-2-ylcarbamoyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22231233) has the molecular formula C23H36F2N2O5 and a molecular weight of 458.55 g/mol. Its IUPAC name is 3-[4-[2-[5,5-difluorohexyl(propan-2-ylcarbamoyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[5,5-difluorohexyl(propan-2-ylcarbamoyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22231233 |
| Molecular Formula | C23H36F2N2O5 |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | 3-[4-[2-[5,5-difluorohexyl(propan-2-ylcarbamoyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCCC(C)(F)F)C(=O)NC(C)C)cc1)C(=O)O |
| InChI | InChI=1S/C23H36F2N2O5/c1-5-31-20(21(28)29)16-18-8-10-19(11-9-18)32-15-14-27(22(30)26-17(2)3)13-7-6-12-23(4,24)25/h8-11,17,20H,5-7,12-16H2,1-4H3,(H,26,30)(H,28,29) |
| InChIKey | BARZEUAXVJSULS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|