C27H33F4NO6 — CID 22230844
3-[4-[2-[6,6-difluoroheptyl-(2,4-difluorophenoxy)carbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22230844) has the molecular formula C27H33F4NO6 and a molecular weight of 543.55 g/mol. Its IUPAC name is 3-[4-[2-[6,6-difluoroheptyl-(2,4-difluorophenoxy)carbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[6,6-difluoroheptyl-(2,4-difluorophenoxy)carbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22230844 |
| Molecular Formula | C27H33F4NO6 |
| Molecular Weight | 543.55 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | 3-[4-[2-[6,6-difluoroheptyl-(2,4-difluorophenoxy)carbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCCCC(C)(F)F)C(=O)Oc2ccc(F)cc2F)cc1)C(=O)O |
| InChI | InChI=1S/C27H33F4NO6/c1-3-36-24(25(33)34)17-19-7-10-21(11-8-19)37-16-15-32(14-6-4-5-13-27(2,30)31)26(35)38-23-12-9-20(28)18-22(23)29/h7-12,18,24H,3-6,13-17H2,1-2H3,(H,33,34) |
| InChIKey | PQVFQGILKDBHMZ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.55 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|