C26H28F7NO6 — CID 22233797
3-[4-[2-[(3,4-difluorophenoxy)carbonyl-(5,5,6,6,6-pentafluorohexyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22233797) has the molecular formula C26H28F7NO6 and a molecular weight of 583.50 g/mol. Its IUPAC name is 3-[4-[2-[(3,4-difluorophenoxy)carbonyl-(5,5,6,6,6-pentafluorohexyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[(3,4-difluorophenoxy)carbonyl-(5,5,6,6,6-pentafluorohexyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22233797 |
| Molecular Formula | C26H28F7NO6 |
| Molecular Weight | 583.50 g/mol |
| Exact Mass | 583.18 |
| IUPAC Name | 3-[4-[2-[(3,4-difluorophenoxy)carbonyl-(5,5,6,6,6-pentafluorohexyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCCC(F)(F)C(F)(F)F)C(=O)Oc2ccc(F)c(F)c2)cc1)C(=O)O |
| InChI | InChI=1S/C26H28F7NO6/c1-2-38-22(23(35)36)15-17-5-7-18(8-6-17)39-14-13-34(12-4-3-11-25(29,30)26(31,32)33)24(37)40-19-9-10-20(27)21(28)16-19/h5-10,16,22H,2-4,11-15H2,1H3,(H,35,36) |
| InChIKey | IDRNPANNBQAXIV-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.50 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|