C28H29F10NO6 — CID 22233500
2-ethoxy-3-[4-[2-[5,5,6,6,7,7,7-heptafluoroheptyl-[3-(trifluoromethyl)phenoxy]carbonylamino]ethoxy]phenyl]propanoic acid (PubChem CID 22233500) has the molecular formula C28H29F10NO6 and a molecular weight of 665.52 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[5,5,6,6,7,7,7-heptafluoroheptyl-[3-(trifluoromethyl)phenoxy]carbonylamino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[5,5,6,6,7,7,7-heptafluoroheptyl-[3-(trifluoromethyl)phenoxy]carbonylamino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22233500 |
| Molecular Formula | C28H29F10NO6 |
| Molecular Weight | 665.52 g/mol |
| Exact Mass | 665.18 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[5,5,6,6,7,7,7-heptafluoroheptyl-[3-(trifluoromethyl)phenoxy]carbonylamino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCCC(F)(F)C(F)(F)C(F)(F)F)C(=O)Oc2cccc(C(F)(F)F)c2)cc1)C(=O)O |
| InChI | InChI=1S/C28H29F10NO6/c1-2-43-22(23(40)41)16-18-8-10-20(11-9-18)44-15-14-39(13-4-3-12-25(29,30)27(34,35)28(36,37)38)24(42)45-21-7-5-6-19(17-21)26(31,32)33/h5-11,17,22H,2-4,12-16H2,1H3,(H,40,41) |
| InChIKey | BMKSLWHOHHBRNN-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.52 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|