C27H35F2NO8 — CID 22230790
3-[4-[2-[2-(3,3-difluorobutoxy)ethyl-(3-methoxyphenoxy)carbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22230790) has the molecular formula C27H35F2NO8 and a molecular weight of 539.57 g/mol. Its IUPAC name is 3-[4-[2-[2-(3,3-difluorobutoxy)ethyl-(3-methoxyphenoxy)carbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[2-(3,3-difluorobutoxy)ethyl-(3-methoxyphenoxy)carbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22230790 |
| Molecular Formula | C27H35F2NO8 |
| Molecular Weight | 539.57 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | 3-[4-[2-[2-(3,3-difluorobutoxy)ethyl-(3-methoxyphenoxy)carbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCOCCC(C)(F)F)C(=O)Oc2cccc(OC)c2)cc1)C(=O)O |
| InChI | InChI=1S/C27H35F2NO8/c1-4-36-24(25(31)32)18-20-8-10-21(11-9-20)37-17-14-30(13-16-35-15-12-27(2,28)29)26(33)38-23-7-5-6-22(19-23)34-3/h5-11,19,24H,4,12-18H2,1-3H3,(H,31,32) |
| InChIKey | BJRVUPIDVVVNMB-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.57 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|