C30H34FNO8 — CID 22232998
2-ethoxy-3-[4-[2-[2-[(4-fluorophenyl)methoxy]ethyl-(3-methoxyphenoxy)carbonylamino]ethoxy]phenyl]propanoic acid (PubChem CID 22232998) has the molecular formula C30H34FNO8 and a molecular weight of 555.60 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[2-[(4-fluorophenyl)methoxy]ethyl-(3-methoxyphenoxy)carbonylamino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[2-[(4-fluorophenyl)methoxy]ethyl-(3-methoxyphenoxy)carbonylamino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22232998 |
| Molecular Formula | C30H34FNO8 |
| Molecular Weight | 555.60 g/mol |
| Exact Mass | 555.23 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[2-[(4-fluorophenyl)methoxy]ethyl-(3-methoxyphenoxy)carbonylamino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCOCc2ccc(F)cc2)C(=O)Oc2cccc(OC)c2)cc1)C(=O)O |
| InChI | InChI=1S/C30H34FNO8/c1-3-38-28(29(33)34)19-22-9-13-25(14-10-22)39-18-16-32(15-17-37-21-23-7-11-24(31)12-8-23)30(35)40-27-6-4-5-26(20-27)36-2/h4-14,20,28H,3,15-19,21H2,1-2H3,(H,33,34) |
| InChIKey | LHFLVLVYWINFGB-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.60 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|