C32H38FNO7 — CID 22229917
2-ethoxy-3-[4-[2-[4-[(4-fluorophenyl)methoxy]butyl-(2-methylphenoxy)carbonylamino]ethoxy]phenyl]propanoic acid (PubChem CID 22229917) has the molecular formula C32H38FNO7 and a molecular weight of 567.65 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[4-[(4-fluorophenyl)methoxy]butyl-(2-methylphenoxy)carbonylamino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[4-[(4-fluorophenyl)methoxy]butyl-(2-methylphenoxy)carbonylamino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22229917 |
| Molecular Formula | C32H38FNO7 |
| Molecular Weight | 567.65 g/mol |
| Exact Mass | 567.26 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[4-[(4-fluorophenyl)methoxy]butyl-(2-methylphenoxy)carbonylamino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCCOCc2ccc(F)cc2)C(=O)Oc2ccccc2C)cc1)C(=O)O |
| InChI | InChI=1S/C32H38FNO7/c1-3-39-30(31(35)36)22-25-12-16-28(17-13-25)40-21-19-34(32(37)41-29-9-5-4-8-24(29)2)18-6-7-20-38-23-26-10-14-27(33)15-11-26/h4-5,8-17,30H,3,6-7,18-23H2,1-2H3,(H,35,36) |
| InChIKey | PXSNLGTXACTAGI-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.65 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|