C31H35BrFNO7 — CID 22233230
3-[4-[2-[(4-bromophenoxy)carbonyl-[4-[(4-fluorophenyl)methoxy]butyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22233230) has the molecular formula C31H35BrFNO7 and a molecular weight of 632.52 g/mol. Its IUPAC name is 3-[4-[2-[(4-bromophenoxy)carbonyl-[4-[(4-fluorophenyl)methoxy]butyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[(4-bromophenoxy)carbonyl-[4-[(4-fluorophenyl)methoxy]butyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22233230 |
| Molecular Formula | C31H35BrFNO7 |
| Molecular Weight | 632.52 g/mol |
| Exact Mass | 631.16 |
| IUPAC Name | 3-[4-[2-[(4-bromophenoxy)carbonyl-[4-[(4-fluorophenyl)methoxy]butyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCCOCc2ccc(F)cc2)C(=O)Oc2ccc(Br)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C31H35BrFNO7/c1-2-39-29(30(35)36)21-23-7-13-27(14-8-23)40-20-18-34(31(37)41-28-15-9-25(32)10-16-28)17-3-4-19-38-22-24-5-11-26(33)12-6-24/h5-16,29H,2-4,17-22H2,1H3,(H,35,36) |
| InChIKey | YGGMNDLLCHTNQI-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.52 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|