C31H36FNO8 — CID 22229551
2-ethoxy-3-[4-[2-[3-[(4-fluorophenyl)methoxy]propyl-(2-methoxyphenoxy)carbonylamino]ethoxy]phenyl]propanoic acid (PubChem CID 22229551) has the molecular formula C31H36FNO8 and a molecular weight of 569.63 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[3-[(4-fluorophenyl)methoxy]propyl-(2-methoxyphenoxy)carbonylamino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[3-[(4-fluorophenyl)methoxy]propyl-(2-methoxyphenoxy)carbonylamino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22229551 |
| Molecular Formula | C31H36FNO8 |
| Molecular Weight | 569.63 g/mol |
| Exact Mass | 569.24 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[3-[(4-fluorophenyl)methoxy]propyl-(2-methoxyphenoxy)carbonylamino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCOCc2ccc(F)cc2)C(=O)Oc2ccccc2OC)cc1)C(=O)O |
| InChI | InChI=1S/C31H36FNO8/c1-3-39-29(30(34)35)21-23-11-15-26(16-12-23)40-20-18-33(31(36)41-28-8-5-4-7-27(28)37-2)17-6-19-38-22-24-9-13-25(32)14-10-24/h4-5,7-16,29H,3,6,17-22H2,1-2H3,(H,34,35) |
| InChIKey | WUFZJLDYXKPCSX-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.63 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|