C30H35FN2O6 — CID 22230245
2-ethoxy-3-[4-[2-[3-[(4-fluorophenyl)methoxy]propyl-(phenylcarbamoyl)amino]ethoxy]phenyl]propanoic acid (PubChem CID 22230245) has the molecular formula C30H35FN2O6 and a molecular weight of 538.62 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[3-[(4-fluorophenyl)methoxy]propyl-(phenylcarbamoyl)amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[3-[(4-fluorophenyl)methoxy]propyl-(phenylcarbamoyl)amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22230245 |
| Molecular Formula | C30H35FN2O6 |
| Molecular Weight | 538.62 g/mol |
| Exact Mass | 538.25 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[3-[(4-fluorophenyl)methoxy]propyl-(phenylcarbamoyl)amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCOCc2ccc(F)cc2)C(=O)Nc2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C30H35FN2O6/c1-2-38-28(29(34)35)21-23-11-15-27(16-12-23)39-20-18-33(30(36)32-26-7-4-3-5-8-26)17-6-19-37-22-24-9-13-25(31)14-10-24/h3-5,7-16,28H,2,6,17-22H2,1H3,(H,32,36)(H,34,35) |
| InChIKey | RIXPSCMRVAZJPH-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.62 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|