C33H41FN2O6 — CID 22231878
2-ethoxy-3-[4-[2-[4-(4-fluorophenoxy)butyl-[(4-propan-2-ylphenyl)carbamoyl]amino]ethoxy]phenyl]propanoic acid (PubChem CID 22231878) has the molecular formula C33H41FN2O6 and a molecular weight of 580.70 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[4-(4-fluorophenoxy)butyl-[(4-propan-2-ylphenyl)carbamoyl]amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[4-(4-fluorophenoxy)butyl-[(4-propan-2-ylphenyl)carbamoyl]amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22231878 |
| Molecular Formula | C33H41FN2O6 |
| Molecular Weight | 580.70 g/mol |
| Exact Mass | 580.29 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[4-(4-fluorophenoxy)butyl-[(4-propan-2-ylphenyl)carbamoyl]amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCCOc2ccc(F)cc2)C(=O)Nc2ccc(C(C)C)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C33H41FN2O6/c1-4-40-31(32(37)38)23-25-7-15-29(16-8-25)42-22-20-36(19-5-6-21-41-30-17-11-27(34)12-18-30)33(39)35-28-13-9-26(10-14-28)24(2)3/h7-18,24,31H,4-6,19-23H2,1-3H3,(H,35,39)(H,37,38) |
| InChIKey | LBIRYCQHZMFHNJ-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.70 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|