C29H42N2O6 — CID 22230548
3-[4-[2-[2-butoxyethyl-[(4-propan-2-ylphenyl)carbamoyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22230548) has the molecular formula C29H42N2O6 and a molecular weight of 514.66 g/mol. Its IUPAC name is 3-[4-[2-[2-butoxyethyl-[(4-propan-2-ylphenyl)carbamoyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[2-butoxyethyl-[(4-propan-2-ylphenyl)carbamoyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22230548 |
| Molecular Formula | C29H42N2O6 |
| Molecular Weight | 514.66 g/mol |
| Exact Mass | 514.30 |
| IUPAC Name | 3-[4-[2-[2-butoxyethyl-[(4-propan-2-ylphenyl)carbamoyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCCCOCCN(CCOc1ccc(CC(OCC)C(=O)O)cc1)C(=O)Nc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C29H42N2O6/c1-5-7-18-35-19-16-31(29(34)30-25-12-10-24(11-13-25)22(3)4)17-20-37-26-14-8-23(9-15-26)21-27(28(32)33)36-6-2/h8-15,22,27H,5-7,16-21H2,1-4H3,(H,30,34)(H,32,33) |
| InChIKey | CALYBVVXFLVEAC-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.66 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|