C28H39ClN2O5 — CID 22232104
3-[4-[2-[(4-chlorophenyl)carbamoyl-octylamino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22232104) has the molecular formula C28H39ClN2O5 and a molecular weight of 519.08 g/mol. Its IUPAC name is 3-[4-[2-[(4-chlorophenyl)carbamoyl-octylamino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[(4-chlorophenyl)carbamoyl-octylamino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22232104 |
| Molecular Formula | C28H39ClN2O5 |
| Molecular Weight | 519.08 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | 3-[4-[2-[(4-chlorophenyl)carbamoyl-octylamino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCCCCCCCN(CCOc1ccc(CC(OCC)C(=O)O)cc1)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H39ClN2O5/c1-3-5-6-7-8-9-18-31(28(34)30-24-14-12-23(29)13-15-24)19-20-36-25-16-10-22(11-17-25)21-26(27(32)33)35-4-2/h10-17,26H,3-9,18-21H2,1-2H3,(H,30,34)(H,32,33) |
| InChIKey | ITXRZNZBZYJQQI-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.08 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|