C27H38N2O5S — CID 22234104
2-ethoxy-3-[4-[2-[2-pentylsulfanylethyl(phenylcarbamoyl)amino]ethoxy]phenyl]propanoic acid (PubChem CID 22234104) has the molecular formula C27H38N2O5S and a molecular weight of 502.68 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[2-pentylsulfanylethyl(phenylcarbamoyl)amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[2-pentylsulfanylethyl(phenylcarbamoyl)amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22234104 |
| Molecular Formula | C27H38N2O5S |
| Molecular Weight | 502.68 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[2-pentylsulfanylethyl(phenylcarbamoyl)amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCCCCSCCN(CCOc1ccc(CC(OCC)C(=O)O)cc1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C27H38N2O5S/c1-3-5-9-19-35-20-17-29(27(32)28-23-10-7-6-8-11-23)16-18-34-24-14-12-22(13-15-24)21-25(26(30)31)33-4-2/h6-8,10-15,25H,3-5,9,16-21H2,1-2H3,(H,28,32)(H,30,31) |
| InChIKey | HSNMLEXWJWCLSF-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.68 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|