C28H39N3O7S — CID 22233755
2-ethoxy-3-[4-[2-[(4-methyl-3-nitrophenyl)carbamoyl-(2-pentylsulfanylethyl)amino]ethoxy]phenyl]propanoic acid (PubChem CID 22233755) has the molecular formula C28H39N3O7S and a molecular weight of 561.70 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[(4-methyl-3-nitrophenyl)carbamoyl-(2-pentylsulfanylethyl)amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[(4-methyl-3-nitrophenyl)carbamoyl-(2-pentylsulfanylethyl)amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22233755 |
| Molecular Formula | C28H39N3O7S |
| Molecular Weight | 561.70 g/mol |
| Exact Mass | 561.25 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[(4-methyl-3-nitrophenyl)carbamoyl-(2-pentylsulfanylethyl)amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCCCCSCCN(CCOc1ccc(CC(OCC)C(=O)O)cc1)C(=O)Nc1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H39N3O7S/c1-4-6-7-17-39-18-15-30(28(34)29-23-11-8-21(3)25(20-23)31(35)36)14-16-38-24-12-9-22(10-13-24)19-26(27(32)33)37-5-2/h8-13,20,26H,4-7,14-19H2,1-3H3,(H,29,34)(H,32,33) |
| InChIKey | CATXNBMDDINHIL-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 131.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.70 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|