C31H36FN3O8 — CID 22230840
2-ethoxy-3-[4-[2-[4-(4-fluorophenoxy)butyl-[(4-methyl-3-nitrophenyl)carbamoyl]amino]ethoxy]phenyl]propanoic acid (PubChem CID 22230840) has the molecular formula C31H36FN3O8 and a molecular weight of 597.64 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[4-(4-fluorophenoxy)butyl-[(4-methyl-3-nitrophenyl)carbamoyl]amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[4-(4-fluorophenoxy)butyl-[(4-methyl-3-nitrophenyl)carbamoyl]amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22230840 |
| Molecular Formula | C31H36FN3O8 |
| Molecular Weight | 597.64 g/mol |
| Exact Mass | 597.25 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[4-(4-fluorophenoxy)butyl-[(4-methyl-3-nitrophenyl)carbamoyl]amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCCOc2ccc(F)cc2)C(=O)Nc2ccc(C)c([N+](=O)[O-])c2)cc1)C(=O)O |
| InChI | InChI=1S/C31H36FN3O8/c1-3-41-29(30(36)37)20-23-7-12-26(13-8-23)43-19-17-34(16-4-5-18-42-27-14-9-24(32)10-15-27)31(38)33-25-11-6-22(2)28(21-25)35(39)40/h6-15,21,29H,3-5,16-20H2,1-2H3,(H,33,38)(H,36,37) |
| InChIKey | ZOYJNOLQAACTLM-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 140.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.64 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|