C26H36N2O5 — CID 22230106
2-ethoxy-3-[4-[2-[(4-methylphenyl)carbamoyl-pentylamino]ethoxy]phenyl]propanoic acid (PubChem CID 22230106) has the molecular formula C26H36N2O5 and a molecular weight of 456.58 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[(4-methylphenyl)carbamoyl-pentylamino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[(4-methylphenyl)carbamoyl-pentylamino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22230106 |
| Molecular Formula | C26H36N2O5 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[(4-methylphenyl)carbamoyl-pentylamino]ethoxy]phenyl]propanoic acid |
| SMILES | CCCCCN(CCOc1ccc(CC(OCC)C(=O)O)cc1)C(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C26H36N2O5/c1-4-6-7-16-28(26(31)27-22-12-8-20(3)9-13-22)17-18-33-23-14-10-21(11-15-23)19-24(25(29)30)32-5-2/h8-15,24H,4-7,16-19H2,1-3H3,(H,27,31)(H,29,30) |
| InChIKey | BLEIJADBVPUOID-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|