C28H40N2O5 — CID 22234350
2-ethoxy-3-[4-[2-[pentyl-[(2,4,6-trimethylphenyl)carbamoyl]amino]ethoxy]phenyl]propanoic acid (PubChem CID 22234350) has the molecular formula C28H40N2O5 and a molecular weight of 484.64 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[pentyl-[(2,4,6-trimethylphenyl)carbamoyl]amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[pentyl-[(2,4,6-trimethylphenyl)carbamoyl]amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22234350 |
| Molecular Formula | C28H40N2O5 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.29 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[pentyl-[(2,4,6-trimethylphenyl)carbamoyl]amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCCCCN(CCOc1ccc(CC(OCC)C(=O)O)cc1)C(=O)Nc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C28H40N2O5/c1-6-8-9-14-30(28(33)29-26-21(4)17-20(3)18-22(26)5)15-16-35-24-12-10-23(11-13-24)19-25(27(31)32)34-7-2/h10-13,17-18,25H,6-9,14-16,19H2,1-5H3,(H,29,33)(H,31,32) |
| InChIKey | KUDIODXNOIRAHF-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|