C26H35ClN2O5 — CID 22233927
3-[4-[2-[(4-chlorophenyl)carbamoyl-hexylamino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22233927) has the molecular formula C26H35ClN2O5 and a molecular weight of 491.03 g/mol. Its IUPAC name is 3-[4-[2-[(4-chlorophenyl)carbamoyl-hexylamino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[(4-chlorophenyl)carbamoyl-hexylamino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22233927 |
| Molecular Formula | C26H35ClN2O5 |
| Molecular Weight | 491.03 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 3-[4-[2-[(4-chlorophenyl)carbamoyl-hexylamino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCCCCCN(CCOc1ccc(CC(OCC)C(=O)O)cc1)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H35ClN2O5/c1-3-5-6-7-16-29(26(32)28-22-12-10-21(27)11-13-22)17-18-34-23-14-8-20(9-15-23)19-24(25(30)31)33-4-2/h8-15,24H,3-7,16-19H2,1-2H3,(H,28,32)(H,30,31) |
| InChIKey | VTJQARICBBSHIO-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.03 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|