C30H31Cl2F3N2O6 — CID 22234463
3-[4-[2-[3-(3,5-dichlorophenoxy)propyl-[[4-(trifluoromethyl)phenyl]carbamoyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22234463) has the molecular formula C30H31Cl2F3N2O6 and a molecular weight of 643.49 g/mol. Its IUPAC name is 3-[4-[2-[3-(3,5-dichlorophenoxy)propyl-[[4-(trifluoromethyl)phenyl]carbamoyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[3-(3,5-dichlorophenoxy)propyl-[[4-(trifluoromethyl)phenyl]carbamoyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22234463 |
| Molecular Formula | C30H31Cl2F3N2O6 |
| Molecular Weight | 643.49 g/mol |
| Exact Mass | 642.15 |
| IUPAC Name | 3-[4-[2-[3-(3,5-dichlorophenoxy)propyl-[[4-(trifluoromethyl)phenyl]carbamoyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCOc2cc(Cl)cc(Cl)c2)C(=O)Nc2ccc(C(F)(F)F)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C30H31Cl2F3N2O6/c1-2-41-27(28(38)39)16-20-4-10-25(11-5-20)43-15-13-37(12-3-14-42-26-18-22(31)17-23(32)19-26)29(40)36-24-8-6-21(7-9-24)30(33,34)35/h4-11,17-19,27H,2-3,12-16H2,1H3,(H,36,40)(H,38,39) |
| InChIKey | XVZFJRMRLVFEEE-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.49 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|