C26H26F10N2O6 — CID 22233794
2-ethoxy-3-[4-[2-[2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl-[[4-(trifluoromethyl)phenyl]carbamoyl]amino]ethoxy]phenyl]propanoic acid (PubChem CID 22233794) has the molecular formula C26H26F10N2O6 and a molecular weight of 652.48 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl-[[4-(trifluoromethyl)phenyl]carbamoyl]amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl-[[4-(trifluoromethyl)phenyl]carbamoyl]amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22233794 |
| Molecular Formula | C26H26F10N2O6 |
| Molecular Weight | 652.48 g/mol |
| Exact Mass | 652.16 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl-[[4-(trifluoromethyl)phenyl]carbamoyl]amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCOC(F)(F)C(F)(F)C(F)(F)F)C(=O)Nc2ccc(C(F)(F)F)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C26H26F10N2O6/c1-2-42-20(21(39)40)15-16-3-9-19(10-4-16)43-13-11-38(12-14-44-26(35,36)24(30,31)25(32,33)34)22(41)37-18-7-5-17(6-8-18)23(27,28)29/h3-10,20H,2,11-15H2,1H3,(H,37,41)(H,39,40) |
| InChIKey | WOSNHXMNPSHCPN-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.48 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|