C26H28F7NO8 — CID 22230124
2-ethoxy-3-[4-[2-[2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl-(4-methoxyphenoxy)carbonylamino]ethoxy]phenyl]propanoic acid (PubChem CID 22230124) has the molecular formula C26H28F7NO8 and a molecular weight of 615.50 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl-(4-methoxyphenoxy)carbonylamino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl-(4-methoxyphenoxy)carbonylamino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22230124 |
| Molecular Formula | C26H28F7NO8 |
| Molecular Weight | 615.50 g/mol |
| Exact Mass | 615.17 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl-(4-methoxyphenoxy)carbonylamino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCOC(F)(F)C(F)(F)C(F)(F)F)C(=O)Oc2ccc(OC)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C26H28F7NO8/c1-3-39-21(22(35)36)16-17-4-6-19(7-5-17)40-14-12-34(23(37)42-20-10-8-18(38-2)9-11-20)13-15-41-26(32,33)24(27,28)25(29,30)31/h4-11,21H,3,12-16H2,1-2H3,(H,35,36) |
| InChIKey | KOCBPHMRLVZWRW-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.50 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|