C20H26F5NO7 — CID 22232610
2-ethoxy-3-[4-[2-[methoxycarbonyl-[3-(1,1,2,2,2-pentafluoroethoxy)propyl]amino]ethoxy]phenyl]propanoic acid (PubChem CID 22232610) has the molecular formula C20H26F5NO7 and a molecular weight of 487.42 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[methoxycarbonyl-[3-(1,1,2,2,2-pentafluoroethoxy)propyl]amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[methoxycarbonyl-[3-(1,1,2,2,2-pentafluoroethoxy)propyl]amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22232610 |
| Molecular Formula | C20H26F5NO7 |
| Molecular Weight | 487.42 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[methoxycarbonyl-[3-(1,1,2,2,2-pentafluoroethoxy)propyl]amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCOC(F)(F)C(F)(F)F)C(=O)OC)cc1)C(=O)O |
| InChI | InChI=1S/C20H26F5NO7/c1-3-31-16(17(27)28)13-14-5-7-15(8-6-14)32-12-10-26(18(29)30-2)9-4-11-33-20(24,25)19(21,22)23/h5-8,16H,3-4,9-13H2,1-2H3,(H,27,28) |
| InChIKey | BRJRGGDJSYCIQW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|