C21H26F7NO7 — CID 22230566
2-ethoxy-3-[4-[2-[ethoxycarbonyl-[2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]amino]ethoxy]phenyl]propanoic acid (PubChem CID 22230566) has the molecular formula C21H26F7NO7 and a molecular weight of 537.43 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[ethoxycarbonyl-[2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[ethoxycarbonyl-[2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22230566 |
| Molecular Formula | C21H26F7NO7 |
| Molecular Weight | 537.43 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[ethoxycarbonyl-[2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(=O)N(CCOc1ccc(CC(OCC)C(=O)O)cc1)CCOC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C21H26F7NO7/c1-3-33-16(17(30)31)13-14-5-7-15(8-6-14)35-11-9-29(18(32)34-4-2)10-12-36-21(27,28)19(22,23)20(24,25)26/h5-8,16H,3-4,9-13H2,1-2H3,(H,30,31) |
| InChIKey | HVXLDJPJISRZBT-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|