C23H29F9N2O6 — CID 22234566
2-ethoxy-3-[4-[2-[2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethyl-(propylcarbamoyl)amino]ethoxy]phenyl]propanoic acid (PubChem CID 22234566) has the molecular formula C23H29F9N2O6 and a molecular weight of 600.48 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethyl-(propylcarbamoyl)amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethyl-(propylcarbamoyl)amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22234566 |
| Molecular Formula | C23H29F9N2O6 |
| Molecular Weight | 600.48 g/mol |
| Exact Mass | 600.19 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethyl-(propylcarbamoyl)amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCCNC(=O)N(CCOc1ccc(CC(OCC)C(=O)O)cc1)CCOC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C23H29F9N2O6/c1-3-9-33-19(37)34(11-13-40-23(31,32)21(26,27)20(24,25)22(28,29)30)10-12-39-16-7-5-15(6-8-16)14-17(18(35)36)38-4-2/h5-8,17H,3-4,9-14H2,1-2H3,(H,33,37)(H,35,36) |
| InChIKey | OETUNUYOMVROIJ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.48 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|