C25H26F7N3O8 — CID 22229552
2-ethoxy-3-[4-[2-[2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl-[(4-nitrophenyl)carbamoyl]amino]ethoxy]phenyl]propanoic acid (PubChem CID 22229552) has the molecular formula C25H26F7N3O8 and a molecular weight of 629.48 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl-[(4-nitrophenyl)carbamoyl]amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl-[(4-nitrophenyl)carbamoyl]amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22229552 |
| Molecular Formula | C25H26F7N3O8 |
| Molecular Weight | 629.48 g/mol |
| Exact Mass | 629.16 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl-[(4-nitrophenyl)carbamoyl]amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCOC(F)(F)C(F)(F)C(F)(F)F)C(=O)Nc2ccc([N+](=O)[O-])cc2)cc1)C(=O)O |
| InChI | InChI=1S/C25H26F7N3O8/c1-2-41-20(21(36)37)15-16-3-9-19(10-4-16)42-13-11-34(12-14-43-25(31,32)23(26,27)24(28,29)30)22(38)33-17-5-7-18(8-6-17)35(39)40/h3-10,20H,2,11-15H2,1H3,(H,33,38)(H,36,37) |
| InChIKey | GBAXDTRYIQEYHJ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 140.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.48 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|