C28H33F7N2O6 — CID 22234101
2-ethoxy-3-[4-[2-[2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl-[(2,4,5-trimethylphenyl)carbamoyl]amino]ethoxy]phenyl]propanoic acid (PubChem CID 22234101) has the molecular formula C28H33F7N2O6 and a molecular weight of 626.57 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl-[(2,4,5-trimethylphenyl)carbamoyl]amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl-[(2,4,5-trimethylphenyl)carbamoyl]amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22234101 |
| Molecular Formula | C28H33F7N2O6 |
| Molecular Weight | 626.57 g/mol |
| Exact Mass | 626.22 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl-[(2,4,5-trimethylphenyl)carbamoyl]amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCOC(F)(F)C(F)(F)C(F)(F)F)C(=O)Nc2cc(C)c(C)cc2C)cc1)C(=O)O |
| InChI | InChI=1S/C28H33F7N2O6/c1-5-41-23(24(38)39)16-20-6-8-21(9-7-20)42-12-10-37(11-13-43-28(34,35)26(29,30)27(31,32)33)25(40)36-22-15-18(3)17(2)14-19(22)4/h6-9,14-15,23H,5,10-13,16H2,1-4H3,(H,36,40)(H,38,39) |
| InChIKey | JTVQYFLHHOYIFY-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.57 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|