C32H40N2O5S — CID 22233278
2-ethoxy-3-[4-[2-[3-phenylsulfanylpropyl-[(2,4,5-trimethylphenyl)carbamoyl]amino]ethoxy]phenyl]propanoic acid (PubChem CID 22233278) has the molecular formula C32H40N2O5S and a molecular weight of 564.75 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[3-phenylsulfanylpropyl-[(2,4,5-trimethylphenyl)carbamoyl]amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[3-phenylsulfanylpropyl-[(2,4,5-trimethylphenyl)carbamoyl]amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22233278 |
| Molecular Formula | C32H40N2O5S |
| Molecular Weight | 564.75 g/mol |
| Exact Mass | 564.27 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[3-phenylsulfanylpropyl-[(2,4,5-trimethylphenyl)carbamoyl]amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCSc2ccccc2)C(=O)Nc2cc(C)c(C)cc2C)cc1)C(=O)O |
| InChI | InChI=1S/C32H40N2O5S/c1-5-38-30(31(35)36)22-26-12-14-27(15-13-26)39-18-17-34(16-9-19-40-28-10-7-6-8-11-28)32(37)33-29-21-24(3)23(2)20-25(29)4/h6-8,10-15,20-21,30H,5,9,16-19,22H2,1-4H3,(H,33,37)(H,35,36) |
| InChIKey | NTHSASPDORAQLZ-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.75 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|