C31H36Cl2N2O6 — CID 22233502
3-[4-[2-[4-(3,5-dichlorophenoxy)butyl-[(2-methylphenyl)carbamoyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22233502) has the molecular formula C31H36Cl2N2O6 and a molecular weight of 603.54 g/mol. Its IUPAC name is 3-[4-[2-[4-(3,5-dichlorophenoxy)butyl-[(2-methylphenyl)carbamoyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[4-(3,5-dichlorophenoxy)butyl-[(2-methylphenyl)carbamoyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22233502 |
| Molecular Formula | C31H36Cl2N2O6 |
| Molecular Weight | 603.54 g/mol |
| Exact Mass | 602.20 |
| IUPAC Name | 3-[4-[2-[4-(3,5-dichlorophenoxy)butyl-[(2-methylphenyl)carbamoyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCCOc2cc(Cl)cc(Cl)c2)C(=O)Nc2ccccc2C)cc1)C(=O)O |
| InChI | InChI=1S/C31H36Cl2N2O6/c1-3-39-29(30(36)37)18-23-10-12-26(13-11-23)41-17-15-35(31(38)34-28-9-5-4-8-22(28)2)14-6-7-16-40-27-20-24(32)19-25(33)21-27/h4-5,8-13,19-21,29H,3,6-7,14-18H2,1-2H3,(H,34,38)(H,36,37) |
| InChIKey | IZACXQRMFJIWQW-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.54 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|