C25H31Cl2NO7 — CID 22232922
3-[4-[2-[4-(3,5-dichlorophenoxy)butyl-methoxycarbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22232922) has the molecular formula C25H31Cl2NO7 and a molecular weight of 528.43 g/mol. Its IUPAC name is 3-[4-[2-[4-(3,5-dichlorophenoxy)butyl-methoxycarbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[4-(3,5-dichlorophenoxy)butyl-methoxycarbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22232922 |
| Molecular Formula | C25H31Cl2NO7 |
| Molecular Weight | 528.43 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | 3-[4-[2-[4-(3,5-dichlorophenoxy)butyl-methoxycarbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCCOc2cc(Cl)cc(Cl)c2)C(=O)OC)cc1)C(=O)O |
| InChI | InChI=1S/C25H31Cl2NO7/c1-3-33-23(24(29)30)14-18-6-8-21(9-7-18)35-13-11-28(25(31)32-2)10-4-5-12-34-22-16-19(26)15-20(27)17-22/h6-9,15-17,23H,3-5,10-14H2,1-2H3,(H,29,30) |
| InChIKey | NNSJSEMLBDRIOJ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.43 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|