C30H30Cl2F3NO7 — CID 22232558
3-[4-[2-[3-(3,5-dichlorophenoxy)propyl-[4-(trifluoromethyl)phenoxy]carbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22232558) has the molecular formula C30H30Cl2F3NO7 and a molecular weight of 644.47 g/mol. Its IUPAC name is 3-[4-[2-[3-(3,5-dichlorophenoxy)propyl-[4-(trifluoromethyl)phenoxy]carbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[3-(3,5-dichlorophenoxy)propyl-[4-(trifluoromethyl)phenoxy]carbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22232558 |
| Molecular Formula | C30H30Cl2F3NO7 |
| Molecular Weight | 644.47 g/mol |
| Exact Mass | 643.14 |
| IUPAC Name | 3-[4-[2-[3-(3,5-dichlorophenoxy)propyl-[4-(trifluoromethyl)phenoxy]carbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCOc2cc(Cl)cc(Cl)c2)C(=O)Oc2ccc(C(F)(F)F)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C30H30Cl2F3NO7/c1-2-40-27(28(37)38)16-20-4-8-24(9-5-20)42-15-13-36(12-3-14-41-26-18-22(31)17-23(32)19-26)29(39)43-25-10-6-21(7-11-25)30(33,34)35/h4-11,17-19,27H,2-3,12-16H2,1H3,(H,37,38) |
| InChIKey | ZFMOZVKAGOJBNU-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.47 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|