C28H34F5NO6 — CID 22234237
3-[4-[2-[6,6-difluoroheptyl-[4-(trifluoromethyl)phenoxy]carbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22234237) has the molecular formula C28H34F5NO6 and a molecular weight of 575.57 g/mol. Its IUPAC name is 3-[4-[2-[6,6-difluoroheptyl-[4-(trifluoromethyl)phenoxy]carbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[6,6-difluoroheptyl-[4-(trifluoromethyl)phenoxy]carbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22234237 |
| Molecular Formula | C28H34F5NO6 |
| Molecular Weight | 575.57 g/mol |
| Exact Mass | 575.23 |
| IUPAC Name | 3-[4-[2-[6,6-difluoroheptyl-[4-(trifluoromethyl)phenoxy]carbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCCCC(C)(F)F)C(=O)Oc2ccc(C(F)(F)F)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C28H34F5NO6/c1-3-38-24(25(35)36)19-20-7-11-22(12-8-20)39-18-17-34(16-6-4-5-15-27(2,29)30)26(37)40-23-13-9-21(10-14-23)28(31,32)33/h7-14,24H,3-6,15-19H2,1-2H3,(H,35,36) |
| InChIKey | OYXAIQGGACZSLS-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.57 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|