C24H37F2NO6 — CID 22234451
3-[4-[2-[butoxycarbonyl(5,5-difluorohexyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22234451) has the molecular formula C24H37F2NO6 and a molecular weight of 473.56 g/mol. Its IUPAC name is 3-[4-[2-[butoxycarbonyl(5,5-difluorohexyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[butoxycarbonyl(5,5-difluorohexyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22234451 |
| Molecular Formula | C24H37F2NO6 |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | 3-[4-[2-[butoxycarbonyl(5,5-difluorohexyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCCCOC(=O)N(CCCCC(C)(F)F)CCOc1ccc(CC(OCC)C(=O)O)cc1 |
| InChI | InChI=1S/C24H37F2NO6/c1-4-6-16-33-23(30)27(14-8-7-13-24(3,25)26)15-17-32-20-11-9-19(10-12-20)18-21(22(28)29)31-5-2/h9-12,21H,4-8,13-18H2,1-3H3,(H,28,29) |
| InChIKey | BAQSMAALVBVAKB-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|