C24H39NO6 — CID 22233587
2-ethoxy-3-[4-[2-[ethoxycarbonyl(octyl)amino]ethoxy]phenyl]propanoic acid (PubChem CID 22233587) has the molecular formula C24H39NO6 and a molecular weight of 437.58 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[ethoxycarbonyl(octyl)amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[ethoxycarbonyl(octyl)amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22233587 |
| Molecular Formula | C24H39NO6 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[ethoxycarbonyl(octyl)amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCCCCCCCN(CCOc1ccc(CC(OCC)C(=O)O)cc1)C(=O)OCC |
| InChI | InChI=1S/C24H39NO6/c1-4-7-8-9-10-11-16-25(24(28)30-6-3)17-18-31-21-14-12-20(13-15-21)19-22(23(26)27)29-5-2/h12-15,22H,4-11,16-19H2,1-3H3,(H,26,27) |
| InChIKey | YXNABVCFIHUWKZ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|