C26H35NO7 — CID 22231068
2-ethoxy-3-[4-[2-[3-phenoxypropyl(propoxycarbonyl)amino]ethoxy]phenyl]propanoic acid (PubChem CID 22231068) has the molecular formula C26H35NO7 and a molecular weight of 473.57 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[3-phenoxypropyl(propoxycarbonyl)amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[3-phenoxypropyl(propoxycarbonyl)amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22231068 |
| Molecular Formula | C26H35NO7 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[3-phenoxypropyl(propoxycarbonyl)amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCCOC(=O)N(CCCOc1ccccc1)CCOc1ccc(CC(OCC)C(=O)O)cc1 |
| InChI | InChI=1S/C26H35NO7/c1-3-17-34-26(30)27(15-8-18-32-22-9-6-5-7-10-22)16-19-33-23-13-11-21(12-14-23)20-24(25(28)29)31-4-2/h5-7,9-14,24H,3-4,8,15-20H2,1-2H3,(H,28,29) |
| InChIKey | UFXXBDFPZVUQTP-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|