C27H37NO7 — CID 22233409
3-[4-[2-[butan-2-yloxycarbonyl(3-phenoxypropyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22233409) has the molecular formula C27H37NO7 and a molecular weight of 487.59 g/mol. Its IUPAC name is 3-[4-[2-[butan-2-yloxycarbonyl(3-phenoxypropyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[butan-2-yloxycarbonyl(3-phenoxypropyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22233409 |
| Molecular Formula | C27H37NO7 |
| Molecular Weight | 487.59 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | 3-[4-[2-[butan-2-yloxycarbonyl(3-phenoxypropyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCOc2ccccc2)C(=O)OC(C)CC)cc1)C(=O)O |
| InChI | InChI=1S/C27H37NO7/c1-4-21(3)35-27(31)28(16-9-18-33-23-10-7-6-8-11-23)17-19-34-24-14-12-22(13-15-24)20-25(26(29)30)32-5-2/h6-8,10-15,21,25H,4-5,9,16-20H2,1-3H3,(H,29,30) |
| InChIKey | XLHIPMSUGUSYGR-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.59 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|