C31H37NO8 — CID 22234213
2-ethoxy-3-[4-[2-[(2-methoxy-5-methylphenoxy)carbonyl-(3-phenoxypropyl)amino]ethoxy]phenyl]propanoic acid (PubChem CID 22234213) has the molecular formula C31H37NO8 and a molecular weight of 551.64 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[(2-methoxy-5-methylphenoxy)carbonyl-(3-phenoxypropyl)amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[(2-methoxy-5-methylphenoxy)carbonyl-(3-phenoxypropyl)amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22234213 |
| Molecular Formula | C31H37NO8 |
| Molecular Weight | 551.64 g/mol |
| Exact Mass | 551.25 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[(2-methoxy-5-methylphenoxy)carbonyl-(3-phenoxypropyl)amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCOc2ccccc2)C(=O)Oc2cc(C)ccc2OC)cc1)C(=O)O |
| InChI | InChI=1S/C31H37NO8/c1-4-37-29(30(33)34)22-24-12-14-26(15-13-24)39-20-18-32(17-8-19-38-25-9-6-5-7-10-25)31(35)40-28-21-23(2)11-16-27(28)36-3/h5-7,9-16,21,29H,4,8,17-20,22H2,1-3H3,(H,33,34) |
| InChIKey | VDUUHRWSXHANSC-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.64 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|