C32H38FNO8 — CID 22231222
2-ethoxy-3-[4-[2-[4-(4-fluorophenoxy)butyl-(2-methoxy-5-methylphenoxy)carbonylamino]ethoxy]phenyl]propanoic acid (PubChem CID 22231222) has the molecular formula C32H38FNO8 and a molecular weight of 583.65 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[4-(4-fluorophenoxy)butyl-(2-methoxy-5-methylphenoxy)carbonylamino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[4-(4-fluorophenoxy)butyl-(2-methoxy-5-methylphenoxy)carbonylamino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22231222 |
| Molecular Formula | C32H38FNO8 |
| Molecular Weight | 583.65 g/mol |
| Exact Mass | 583.26 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[4-(4-fluorophenoxy)butyl-(2-methoxy-5-methylphenoxy)carbonylamino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCCOc2ccc(F)cc2)C(=O)Oc2cc(C)ccc2OC)cc1)C(=O)O |
| InChI | InChI=1S/C32H38FNO8/c1-4-39-30(31(35)36)22-24-8-12-26(13-9-24)41-20-18-34(17-5-6-19-40-27-14-10-25(33)11-15-27)32(37)42-29-21-23(2)7-16-28(29)38-3/h7-16,21,30H,4-6,17-20,22H2,1-3H3,(H,35,36) |
| InChIKey | RTEDQCRBUSQIAN-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.65 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|