C27H30F7NO8 — CID 22230445
2-ethoxy-3-[4-[2-[2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl-(2-methoxy-5-methylphenoxy)carbonylamino]ethoxy]phenyl]propanoic acid (PubChem CID 22230445) has the molecular formula C27H30F7NO8 and a molecular weight of 629.52 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl-(2-methoxy-5-methylphenoxy)carbonylamino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl-(2-methoxy-5-methylphenoxy)carbonylamino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22230445 |
| Molecular Formula | C27H30F7NO8 |
| Molecular Weight | 629.52 g/mol |
| Exact Mass | 629.19 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl-(2-methoxy-5-methylphenoxy)carbonylamino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCOC(F)(F)C(F)(F)C(F)(F)F)C(=O)Oc2cc(C)ccc2OC)cc1)C(=O)O |
| InChI | InChI=1S/C27H30F7NO8/c1-4-40-22(23(36)37)16-18-6-8-19(9-7-18)41-13-11-35(12-14-42-27(33,34)25(28,29)26(30,31)32)24(38)43-21-15-17(2)5-10-20(21)39-3/h5-10,15,22H,4,11-14,16H2,1-3H3,(H,36,37) |
| InChIKey | VNHVKSNCFKZZGH-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.52 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|