C30H30F13NO6 — CID 22229576
2-ethoxy-3-[4-[2-[2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl-(2,4,5-trimethylphenoxy)carbonylamino]ethoxy]phenyl]propanoic acid (PubChem CID 22229576) has the molecular formula C30H30F13NO6 and a molecular weight of 747.55 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl-(2,4,5-trimethylphenoxy)carbonylamino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl-(2,4,5-trimethylphenoxy)carbonylamino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22229576 |
| Molecular Formula | C30H30F13NO6 |
| Molecular Weight | 747.55 g/mol |
| Exact Mass | 747.19 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl-(2,4,5-trimethylphenoxy)carbonylamino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)Oc2cc(C)c(C)cc2C)cc1)C(=O)O |
| InChI | InChI=1S/C30H30F13NO6/c1-5-48-22(23(45)46)14-19-6-8-20(9-7-19)49-11-10-44(24(47)50-21-13-17(3)16(2)12-18(21)4)15-25(31,32)26(33,34)27(35,36)28(37,38)29(39,40)30(41,42)43/h6-9,12-13,22H,5,10-11,14-15H2,1-4H3,(H,45,46) |
| InChIKey | MZBPDMQLIDWGNV-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.55 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|