C26H30F11NO6 — CID 22232837
3-[4-[2-[cyclohexyloxycarbonyl(2,2,3,3,4,4,5,5,6,6,6-undecafluorohexyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22232837) has the molecular formula C26H30F11NO6 and a molecular weight of 661.51 g/mol. Its IUPAC name is 3-[4-[2-[cyclohexyloxycarbonyl(2,2,3,3,4,4,5,5,6,6,6-undecafluorohexyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[cyclohexyloxycarbonyl(2,2,3,3,4,4,5,5,6,6,6-undecafluorohexyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22232837 |
| Molecular Formula | C26H30F11NO6 |
| Molecular Weight | 661.51 g/mol |
| Exact Mass | 661.19 |
| IUPAC Name | 3-[4-[2-[cyclohexyloxycarbonyl(2,2,3,3,4,4,5,5,6,6,6-undecafluorohexyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)OC2CCCCC2)cc1)C(=O)O |
| InChI | InChI=1S/C26H30F11NO6/c1-2-42-19(20(39)40)14-16-8-10-17(11-9-16)43-13-12-38(21(41)44-18-6-4-3-5-7-18)15-22(27,28)23(29,30)24(31,32)25(33,34)26(35,36)37/h8-11,18-19H,2-7,12-15H2,1H3,(H,39,40) |
| InChIKey | LDOUISNDOWGQSB-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.51 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|